Products 948293-83-2

CAS 948293-83-2 appears in our catalog under these names: 5,7-Dichloroquinoline-3-carboxylic acid, 95%, 5,7-Dichloroquinoline-3-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

5,7-dichloroquinoline-3-carboxylic acid (CAS 948293-83-2) is a chemical compound with the molecular formula C10H5Cl2NO2 and a molecular weight of 242.05 g/mol. IUPAC name: 5,7-dichloroquinoline-3-carboxylic acid. InChIKey: KSVXPOMGBAOWQL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H5Cl2NO2
Molecular weight242.05 g/mol
IUPAC name5,7-dichloroquinoline-3-carboxylic acid
InChIKeyKSVXPOMGBAOWQL-UHFFFAOYSA-N
SMILESC1=C(C=C(C2=C1N=CC(=C2)C(=O)O)Cl)Cl

Computed by PubChem (NCBI)