CAS 630067-21-9 appears in our catalog under these names: Hydroxychloroquine Impurity 15, Hydroxychloroquine sulfate Impurity 20. Offered by: Chemat Brand. Available pack sizes: on request.
4,7-dichloroquinoline-3-carboxylic acid (CAS 630067-21-9) is a chemical compound with the molecular formula C10H5Cl2NO2 and a molecular weight of 242.05 g/mol. IUPAC name: 4,7-dichloroquinoline-3-carboxylic acid. InChIKey: MLBIOMJMHCNLEL-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2NO2 |
|---|---|
| Molecular weight | 242.05 g/mol |
| IUPAC name | 4,7-dichloroquinoline-3-carboxylic acid |
| InChIKey | MLBIOMJMHCNLEL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=CN=C2C=C1Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)