CAS 948294-42-6 appears in our catalog under these names: 6,7-Dichloroquinoline-3-carboxylic acid, 95%, 6,7-Dichloroquinoline-3-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
6,7-dichloroquinoline-3-carboxylic acid (CAS 948294-42-6) is a chemical compound with the molecular formula C10H5Cl2NO2 and a molecular weight of 242.05 g/mol. IUPAC name: 6,7-dichloroquinoline-3-carboxylic acid. InChIKey: QVIQAMKOZUQRKA-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2NO2 |
|---|---|
| Molecular weight | 242.05 g/mol |
| IUPAC name | 6,7-dichloroquinoline-3-carboxylic acid |
| InChIKey | QVIQAMKOZUQRKA-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(C(=CC2=NC=C1C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)