Products 902742-67-0
CAS 902742-67-0 appears in our catalog under these names: 4,6-Dichloro-2-quinolinecarboxylic acid, 95%, 4,6-Dichloroquinoline-2-carboxylic acid, 98%, 4,6-Dichloroquinoline-2-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 10g, 50mg, 0,5g.
4,6-dichloroquinoline-2-carboxylic acid (CAS 902742-67-0) is a chemical compound with the molecular formula C10H5Cl2NO2 and a molecular weight of 242.05 g/mol. IUPAC name: 4,6-dichloroquinoline-2-carboxylic acid. InChIKey: KBYSXQKAWAUVJZ-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2NO2 |
|---|---|
| Molecular weight | 242.05 g/mol |
| IUPAC name | 4,6-dichloroquinoline-2-carboxylic acid |
| InChIKey | KBYSXQKAWAUVJZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=CC(=N2)C(=O)O)Cl |
Computed by PubChem (NCBI)