CAS 1416712-68-9 appears in our catalog under these names: 1,3-Dichloroisoquinoline-6-carboxylic acid, 95%, 1,3-Dichloroisoquinoline-6-carboxylic acid 95%, 1,3-Dichloroisoquinoline-6-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 500mg, 100mg, 250mg, 1g.
1,3-dichloroisoquinoline-6-carboxylic acid (CAS 1416712-68-9) is a chemical compound with the molecular formula C10H5Cl2NO2 and a molecular weight of 242.05 g/mol. IUPAC name: 1,3-dichloroisoquinoline-6-carboxylic acid. InChIKey: KTZMHKYHEQOTGW-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2NO2 |
|---|---|
| Molecular weight | 242.05 g/mol |
| IUPAC name | 1,3-dichloroisoquinoline-6-carboxylic acid |
| InChIKey | KTZMHKYHEQOTGW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=C(C=C2C=C1C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)