CAS 37010-53-0 is the registry number for 1-(2,3-Dichlorophenyl)-2,5-dihydro-1h-pyrrole-2,5-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(2,3-dichlorophenyl)pyrrole-2,5-dione (CAS 37010-53-0) is a chemical compound with the molecular formula C10H5Cl2NO2 and a molecular weight of 242.05 g/mol. IUPAC name: 1-(2,3-dichlorophenyl)pyrrole-2,5-dione. InChIKey: YSVTWQFPUVGTDE-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2NO2 |
|---|---|
| Molecular weight | 242.05 g/mol |
| IUPAC name | 1-(2,3-dichlorophenyl)pyrrole-2,5-dione |
| InChIKey | YSVTWQFPUVGTDE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)N2C(=O)C=CC2=O |
Computed by PubChem (NCBI)