CAS 1269062-26-1 is the registry number for 1,3-Benzothiazole-2-carboxylic acid hydrate, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 250mg, 1g.
1,3-benzothiazole-2-carboxylic acid;hydrate (CAS 1269062-26-1) is a chemical compound with the molecular formula C8H7NO3S and a molecular weight of 197.21 g/mol. IUPAC name: 1,3-benzothiazole-2-carboxylic acid;hydrate. InChIKey: PZVDFIOWLQMNSN-UHFFFAOYSA-N.
| Molecular formula | C8H7NO3S |
|---|---|
| Molecular weight | 197.21 g/mol |
| IUPAC name | 1,3-benzothiazole-2-carboxylic acid;hydrate |
| InChIKey | PZVDFIOWLQMNSN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)C(=O)O.O |
Computed by PubChem (NCBI)