CAS 18712-14-6 appears in our catalog under these names: 3-Methoxy-1,2-benzothiazole 1,1-dioxide, >95% (HPLC), 3-Methoxybenzo[d]isothiazole 1,1-dioxide 97%, 3-Methoxybenzo[d]isothiazole 1,1-dioxide, 97%, 3-Methoxybenzo[d]isothiazole 1,1-dioxide, 97%, 97%. Offered by: TRC, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 10mg, 50mg, 250mg, 1g, 5g.
3-methoxy-1,2-benzothiazole 1,1-dioxide (CAS 18712-14-6) is a chemical compound with the molecular formula C8H7NO3S and a molecular weight of 197.21 g/mol. IUPAC name: 3-methoxy-1,2-benzothiazole 1,1-dioxide. InChIKey: LGFRHWQFYVQIFJ-UHFFFAOYSA-N.
| Molecular formula | C8H7NO3S |
|---|---|
| Molecular weight | 197.21 g/mol |
| IUPAC name | 3-methoxy-1,2-benzothiazole 1,1-dioxide |
| InChIKey | LGFRHWQFYVQIFJ-UHFFFAOYSA-N |
| SMILES | COC1=NS(=O)(=O)C2=CC=CC=C21 |
Computed by PubChem (NCBI)