Products 15119-62-7
CAS 15119-62-7 is the registry number for p-Nitrophenylthiol Acetate, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 1g, 500mg.
S-(4-nitrophenyl) ethanethioate (CAS 15119-62-7) is a chemical compound with the molecular formula C8H7NO3S and a molecular weight of 197.21 g/mol. IUPAC name: S-(4-nitrophenyl) ethanethioate. InChIKey: QCGPFSMQZNLBCA-UHFFFAOYSA-N.
| Molecular formula | C8H7NO3S |
|---|---|
| Molecular weight | 197.21 g/mol |
| IUPAC name | S-(4-nitrophenyl) ethanethioate |
| InChIKey | QCGPFSMQZNLBCA-UHFFFAOYSA-N |
| SMILES | CC(=O)SC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
p-Nitrophenylthiol acetate, 4-Nitrophenylthiol acetate, Ethanethioic acid, S-(4-nitrophenyl) ester, S-(4-nitrophenyl) ethanethioate, S-(p-Nitrophenyl) thioacetate, Benzenethiol, p-nitro-, acetate, 1-[(4-nitrophenyl)sulfanyl]ethan-1-one, ACETIC ACID, THIO-, S-(p-NITROPHENYL) ESTER, S-(4-nitrophenyl) thioacetate, S-(4-nitrophenyl)ethanethioate