CAS 956576-57-1 is the registry number for Methyl 2-isocyanato-5-methylthiophene-3-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Methyl 2-isocyanato-5-methylthiophene-3-carboxylate (CAS 956576-57-1) is a chemical compound with the molecular formula C8H7NO3S and a molecular weight of 197.21 g/mol. IUPAC name: methyl 2-isocyanato-5-methylthiophene-3-carboxylate. InChIKey: XIPRWOYTEWWUIZ-UHFFFAOYSA-N.
| Molecular formula | C8H7NO3S |
|---|---|
| Molecular weight | 197.21 g/mol |
| IUPAC name | methyl 2-isocyanato-5-methylthiophene-3-carboxylate |
| InChIKey | XIPRWOYTEWWUIZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(S1)N=C=O)C(=O)OC |
Computed by PubChem (NCBI)