CAS 173374-31-7 appears in our catalog under these names: 5,6-Dimethyl-1H,2H,4H-thieno(2,3-d)(1,3)oxazine-2,4-dione, 95%, 5,6-Dimethyl-1H,2H,4H-thieno(2,3-d)(1,3)oxazine-2,4-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5,6-dimethyl-1H-thieno[2,3-d][1,3]oxazine-2,4-dione (CAS 173374-31-7) is a chemical compound with the molecular formula C8H7NO3S and a molecular weight of 197.21 g/mol. IUPAC name: 5,6-dimethyl-1H-thieno[2,3-d][1,3]oxazine-2,4-dione. InChIKey: GZENPAIGBVRRTH-UHFFFAOYSA-N.
| Molecular formula | C8H7NO3S |
|---|---|
| Molecular weight | 197.21 g/mol |
| IUPAC name | 5,6-dimethyl-1H-thieno[2,3-d][1,3]oxazine-2,4-dione |
| InChIKey | GZENPAIGBVRRTH-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=O)OC(=O)N2)C |
Computed by PubChem (NCBI)