CAS 15448-99-4 appears in our catalog under these names: 2-Methyl-1,1-dioxo-1,2-benzothiazol-3-one, N-Methylsaccharin, N–Methylsaccharin, N-Methylsaccharin, >98.0%(GC), 2-Methylbenzo[d]isothiazol-3(2H)-one 1,1-dioxide 95%. Offered by: TRC, Mikromol, GLPBio, TCI, Ambeed. Available pack sizes: 2,5g, 25mg, 100mg, 5g, 25g, 250mg, 1g, 10g.
2-methyl-1,1-dioxo-1,2-benzothiazol-3-one (CAS 15448-99-4) is a chemical compound with the molecular formula C8H7NO3S and a molecular weight of 197.21 g/mol. IUPAC name: 2-methyl-1,1-dioxo-1,2-benzothiazol-3-one. InChIKey: DDIIAJRLFATEEE-UHFFFAOYSA-N.
| Molecular formula | C8H7NO3S |
|---|---|
| Molecular weight | 197.21 g/mol |
| IUPAC name | 2-methyl-1,1-dioxo-1,2-benzothiazol-3-one |
| InChIKey | DDIIAJRLFATEEE-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C2=CC=CC=C2S1(=O)=O |
Computed by PubChem (NCBI)