CAS 18712-21-5 is the registry number for 2-(Methyl-d3)benzo(d)isothiazol-3(2H)-one 1,1-Dioxide. Offered by: TRC. Available pack sizes: 250mg.
1,1-dioxo-2-(trideuteriomethyl)-1,2-benzothiazol-3-one (CAS 18712-21-5) is a chemical compound with the molecular formula C8H7NO3S and a molecular weight of 200.23 g/mol. IUPAC name: 1,1-dioxo-2-(trideuteriomethyl)-1,2-benzothiazol-3-one. InChIKey: DDIIAJRLFATEEE-FIBGUPNXSA-N.
| Molecular formula | C8H7NO3S |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | 1,1-dioxo-2-(trideuteriomethyl)-1,2-benzothiazol-3-one |
| InChIKey | DDIIAJRLFATEEE-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C(=O)C2=CC=CC=C2S1(=O)=O |
Computed by PubChem (NCBI)