CAS 2799-68-0 appears in our catalog under these names: 2H-1,4-Benzothiazin-3(4h)-one 1,1-dioxide, 95%, 2H–Benzo(b)(1,4)thiazin–3(4H)–one 1,1–dioxide. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
1,1-dioxo-4H-1lambda6,4-benzothiazin-3-one (CAS 2799-68-0) is a chemical compound with the molecular formula C8H7NO3S and a molecular weight of 197.21 g/mol. IUPAC name: 1,1-dioxo-4H-1lambda6,4-benzothiazin-3-one. InChIKey: YIWUEDSIYPTYEF-UHFFFAOYSA-N.
| Molecular formula | C8H7NO3S |
|---|---|
| Molecular weight | 197.21 g/mol |
| IUPAC name | 1,1-dioxo-4H-1lambda6,4-benzothiazin-3-one |
| InChIKey | YIWUEDSIYPTYEF-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=CC=CC=C2S1(=O)=O |
Computed by PubChem (NCBI)