CAS 937681-80-6 is the registry number for 3-(Thiophen-2-yl)-4,5-dihydroisoxazole-5-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-thiophen-2-yl-4,5-dihydro-1,2-oxazole-5-carboxylic acid (CAS 937681-80-6) is a chemical compound with the molecular formula C8H7NO3S and a molecular weight of 197.21 g/mol. IUPAC name: 3-thiophen-2-yl-4,5-dihydro-1,2-oxazole-5-carboxylic acid. InChIKey: URKBJWLDOMRNCE-UHFFFAOYSA-N.
| Molecular formula | C8H7NO3S |
|---|---|
| Molecular weight | 197.21 g/mol |
| IUPAC name | 3-thiophen-2-yl-4,5-dihydro-1,2-oxazole-5-carboxylic acid |
| InChIKey | URKBJWLDOMRNCE-UHFFFAOYSA-N |
| SMILES | C1C(ON=C1C2=CC=CS2)C(=O)O |
Computed by PubChem (NCBI)