CAS 926253-88-5 is the registry number for 4-((2-Amino-1,3-thiazol-5-yl)methyl)benzonitrile, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-[(2-amino-1,3-thiazol-5-yl)methyl]benzonitrile (CAS 926253-88-5) is a chemical compound with the molecular formula C11H9N3S and a molecular weight of 215.28 g/mol. IUPAC name: 4-[(2-amino-1,3-thiazol-5-yl)methyl]benzonitrile. InChIKey: NUWMUMONNDCDEZ-UHFFFAOYSA-N.
| Molecular formula | C11H9N3S |
|---|---|
| Molecular weight | 215.28 g/mol |
| IUPAC name | 4-[(2-amino-1,3-thiazol-5-yl)methyl]benzonitrile |
| InChIKey | NUWMUMONNDCDEZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=CN=C(S2)N)C#N |
Computed by PubChem (NCBI)