CAS 22258-56-6 appears in our catalog under these names: 4-(1H-Indol-3-yl)thiazol-2-amine, 95+%, 4-(1H-Indol-3-yl)-thiazol-2-ylamine. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 1g, 100mg.
4-(1H-indol-3-yl)-1,3-thiazol-2-amine (CAS 22258-56-6) is a chemical compound with the molecular formula C11H9N3S and a molecular weight of 215.28 g/mol. IUPAC name: 4-(1H-indol-3-yl)-1,3-thiazol-2-amine. InChIKey: ZACIGHHWMWRYSZ-UHFFFAOYSA-N.
| Molecular formula | C11H9N3S |
|---|---|
| Molecular weight | 215.28 g/mol |
| IUPAC name | 4-(1H-indol-3-yl)-1,3-thiazol-2-amine |
| InChIKey | ZACIGHHWMWRYSZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C3=CSC(=N3)N |
Computed by PubChem (NCBI)