CAS 937628-94-9 appears in our catalog under these names: 3-((2-Amino-1,3-thiazol-5-yl)methyl)benzonitrile, 95%, 3-((2-Amino-1,3-thiazol-5-yl)methyl)benzonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-[(2-amino-1,3-thiazol-5-yl)methyl]benzonitrile (CAS 937628-94-9) is a chemical compound with the molecular formula C11H9N3S and a molecular weight of 215.28 g/mol. IUPAC name: 3-[(2-amino-1,3-thiazol-5-yl)methyl]benzonitrile. InChIKey: SKNZXODPOJPEHV-UHFFFAOYSA-N.
| Molecular formula | C11H9N3S |
|---|---|
| Molecular weight | 215.28 g/mol |
| IUPAC name | 3-[(2-amino-1,3-thiazol-5-yl)methyl]benzonitrile |
| InChIKey | SKNZXODPOJPEHV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C#N)CC2=CN=C(S2)N |
Computed by PubChem (NCBI)