CAS 183668-02-2 appears in our catalog under these names: 4-Imidazo[2,1-b][1,3]thiazol-6-ylaniline, 95%, 4-Imidazo(2,1-b)(1,3)thiazol-6-ylaniline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 2,5g.
4-imidazo[2,1-b][1,3]thiazol-6-ylaniline (CAS 183668-02-2) is a chemical compound with the molecular formula C11H9N3S and a molecular weight of 215.28 g/mol. IUPAC name: 4-imidazo[2,1-b][1,3]thiazol-6-ylaniline. InChIKey: RYXSOPRSCTXCTD-UHFFFAOYSA-N.
| Molecular formula | C11H9N3S |
|---|---|
| Molecular weight | 215.28 g/mol |
| IUPAC name | 4-imidazo[2,1-b][1,3]thiazol-6-ylaniline |
| InChIKey | RYXSOPRSCTXCTD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN3C=CSC3=N2)N |
Computed by PubChem (NCBI)