CAS 1105195-06-9 appears in our catalog under these names: 2-(Thiophen-2-yl)imidazo[1,2-a]pyridin-3-amine, 95%, 2-(Thiophen-2-yl)imidazo(1,2-a)pyridin-3-amine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
2-thiophen-2-ylimidazo[1,2-a]pyridin-3-amine (CAS 1105195-06-9) is a chemical compound with the molecular formula C11H9N3S and a molecular weight of 215.28 g/mol. IUPAC name: 2-thiophen-2-ylimidazo[1,2-a]pyridin-3-amine. InChIKey: LUZIWUCNVIOBGG-UHFFFAOYSA-N.
| Molecular formula | C11H9N3S |
|---|---|
| Molecular weight | 215.28 g/mol |
| IUPAC name | 2-thiophen-2-ylimidazo[1,2-a]pyridin-3-amine |
| InChIKey | LUZIWUCNVIOBGG-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=C(N2C=C1)N)C3=CC=CS3 |
Computed by PubChem (NCBI)