CAS 35359-27-4 is the registry number for 5-Methyl-[1,2,4]triazolo[4,3-a]quinoline-1-thiol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-methyl-2H-[1,2,4]triazolo[4,3-a]quinoline-1-thione (CAS 35359-27-4) is a chemical compound with the molecular formula C11H9N3S and a molecular weight of 215.28 g/mol. IUPAC name: 5-methyl-2H-[1,2,4]triazolo[4,3-a]quinoline-1-thione. InChIKey: VSUPYSJUZGXREB-UHFFFAOYSA-N.
| Molecular formula | C11H9N3S |
|---|---|
| Molecular weight | 215.28 g/mol |
| IUPAC name | 5-methyl-2H-[1,2,4]triazolo[4,3-a]quinoline-1-thione |
| InChIKey | VSUPYSJUZGXREB-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NNC(=S)N2C3=CC=CC=C13 |
Computed by PubChem (NCBI)