CAS 861206-26-0 appears in our catalog under these names: 3-(Imidazo[2,1-b][1,3]thiazol-6-yl)aniline, 95%, 3-(Imidazo(2,1-b)thiazol-6-yl)aniline, 98%, 3-(Imidazo(2,1-b)(1,3)thiazol-6-yl)aniline. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 25g, 0,5g.
3-imidazo[2,1-b][1,3]thiazol-6-ylaniline (CAS 861206-26-0) is a chemical compound with the molecular formula C11H9N3S and a molecular weight of 215.28 g/mol. IUPAC name: 3-imidazo[2,1-b][1,3]thiazol-6-ylaniline. InChIKey: ASXLSRKDSOSGQE-UHFFFAOYSA-N.
| Molecular formula | C11H9N3S |
|---|---|
| Molecular weight | 215.28 g/mol |
| IUPAC name | 3-imidazo[2,1-b][1,3]thiazol-6-ylaniline |
| InChIKey | ASXLSRKDSOSGQE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=CN3C=CSC3=N2 |
Computed by PubChem (NCBI)