cas: 495-71-6 — see every product listed under this CAS number, including other names
1,4-Diphenyl-1,4-butanedione, 98% (CAS 495-71-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F304280-1G |
| cas | 495-71-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 195.78 Pln | |
| Fluorochem | 5g | 487.35 Pln | |
| Fluorochem | 25g | 1716.08 Pln | |
| Fluorochem | 100g | 6698.70 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
1,4-diphenylbutane-1,4-dione (CAS 495-71-6) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: 1,4-diphenylbutane-1,4-dione. InChIKey: OSWWFLDIIGGSJV-UHFFFAOYSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 1,4-diphenylbutane-1,4-dione |
| InChIKey | OSWWFLDIIGGSJV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CCC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)