1,5-Dibromonaphthalene-2,6-diol, 97%
cas: 132178-78-0 — see every product listed under this CAS number, including other names
1,5-Dibromonaphthalene-2,6-diol, 97% (CAS 132178-78-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A224759-250mg |
| cas | 132178-78-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 159.00 Pln | |
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 387.06 Pln | |
| Ambeed | 25g | 1649.75 Pln | |
| Ambeed | 100g | 5437.81 Pln | |
| BLDpharm | 250mg | 142.20 Pln | |
| BLDpharm | 1g | 197.73 Pln | |
| BLDpharm | 5g | 414.32 Pln | |
| BLDpharm | 25g | 1774.96 Pln | |
| BLDpharm | 100g | 5856.85 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1,5-dibromonaphthalene-2,6-diol (CAS 132178-78-0) is a chemical compound with the molecular formula C10H6Br2O2 and a molecular weight of 317.96 g/mol. IUPAC name: 1,5-dibromonaphthalene-2,6-diol. InChIKey: COJNHIANORGBGY-UHFFFAOYSA-N.
| Molecular formula | C10H6Br2O2 |
|---|---|
| Molecular weight | 317.96 g/mol |
| IUPAC name | 1,5-dibromonaphthalene-2,6-diol |
| InChIKey | COJNHIANORGBGY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=C(C=C2)O)Br)Br)O |
Computed by PubChem (NCBI)