CAS 96965-79-6 appears in our catalog under these names: 3,6–Dibromonaphthalene–2,7–diol, 3,6-Dibromo-2,7-dihydroxynaphthalene, >98.0%(GC), 3,6-Dibromonaphthalene-2,7-diol 97%, 2,7-Naphthalenediol, 3,6-dibromo-, 97%, 97%, 3,6-Dibromonaphthalene-2,7-diol, 97%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 100g.
3,6-dibromonaphthalene-2,7-diol (CAS 96965-79-6) is a chemical compound with the molecular formula C10H6Br2O2 and a molecular weight of 317.96 g/mol. IUPAC name: 3,6-dibromonaphthalene-2,7-diol. InChIKey: UAECXNARJOIHAO-UHFFFAOYSA-N.
| Molecular formula | C10H6Br2O2 |
|---|---|
| Molecular weight | 317.96 g/mol |
| IUPAC name | 3,6-dibromonaphthalene-2,7-diol |
| InChIKey | UAECXNARJOIHAO-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(C(=CC2=CC(=C1O)Br)Br)O |
Computed by PubChem (NCBI)