CAS 1262772-95-1 is the registry number for 1-(Benzofuran-2-yl)-2,2-dibromoethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(1-benzofuran-2-yl)-2,2-dibromoethanone (CAS 1262772-95-1) is a chemical compound with the molecular formula C10H6Br2O2 and a molecular weight of 317.96 g/mol. IUPAC name: 1-(1-benzofuran-2-yl)-2,2-dibromoethanone. InChIKey: CCOFPSORMZRGGI-UHFFFAOYSA-N.
| Molecular formula | C10H6Br2O2 |
|---|---|
| Molecular weight | 317.96 g/mol |
| IUPAC name | 1-(1-benzofuran-2-yl)-2,2-dibromoethanone |
| InChIKey | CCOFPSORMZRGGI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(O2)C(=O)C(Br)Br |
Computed by PubChem (NCBI)