CAS 87664-74-2 is the registry number for 6,8-Dibromo-3-methyl-2H-chromen-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6,8-dibromo-3-methylchromen-2-one (CAS 87664-74-2) is a chemical compound with the molecular formula C10H6Br2O2 and a molecular weight of 317.96 g/mol. IUPAC name: 6,8-dibromo-3-methylchromen-2-one. InChIKey: KTSSQWGWUWRXGJ-UHFFFAOYSA-N.
| Molecular formula | C10H6Br2O2 |
|---|---|
| Molecular weight | 317.96 g/mol |
| IUPAC name | 6,8-dibromo-3-methylchromen-2-one |
| InChIKey | KTSSQWGWUWRXGJ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=CC(=CC(=C2OC1=O)Br)Br |
Computed by PubChem (NCBI)