Products 84-59-3
CAS 84-59-3 appears in our catalog under these names: 2,6-Dibromonaphthalene-1,5-diol, 97%, 2，6–Dibromo–1，5–dihydroxynaphthalene, 2,6-Dibromo-1,5-dihydroxynaphthalene, >93.0%(T), 2,6-Dibromonaphthalene-1,5-diol 93%, 2,6-Dibromonaphthalene-1,5-diol, 96%, 96%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 250mg, 25g, 5g, 1g, 100mg, 100g.
2,6-dibromonaphthalene-1,5-diol (CAS 84-59-3) is a chemical compound with the molecular formula C10H6Br2O2 and a molecular weight of 317.96 g/mol. IUPAC name: 2,6-dibromonaphthalene-1,5-diol. InChIKey: GHJUWGHWJYULLK-UHFFFAOYSA-N.
| Molecular formula | C10H6Br2O2 |
|---|---|
| Molecular weight | 317.96 g/mol |
| IUPAC name | 2,6-dibromonaphthalene-1,5-diol |
| InChIKey | GHJUWGHWJYULLK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=C(C=C2)Br)O)O)Br |
Computed by PubChem (NCBI)
Synonyms:
2,6-Dibromonaphthalene-1,5-diol, 2,6-Dibromo-1,5-dihydroxynaphthalene, 2,6-Dibromo-1,5-naphthalenediol, 1,5-Naphthalenediol, 2,6-dibromo-, GHJUWGHWJYULLK-UHFFFAOYSA-N, 1,5-Dihydroxy-2,6-dibromonaphthalene, 1, 2,6-dibromo-, 2,6-dibromo-1,5-di h, 2,6-bis(bromanyl)naphthalene-1,5-diol, 2,6-dibromo-1,5-di hydroxynaphthalene