CAS 32846-64-3 appears in our catalog under these names: 4,7-Dibromotricyclo[5.2.1.0^{2,6}]deca-4,8-diene-3,10-dione, 97%, 4,7-Dibromotricyclo(5.2.1.0^{2,6})deca-4,8-diene-3,10-dione, 2,4–Dibromo–3a,4,7,7a–tetrahydro–1H–4,7–methanoindene–1,8–dione, 2,4-Dibromo-3a,4,7,7a-tetrahydro-1H-4,7-methanoindene-1,8-dione, 95%, 95%. Offered by: Combi-blocks, TRC, GLPBio, Chemat. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg.
4,7-dibromotricyclo[5.2.1.02,6]deca-4,8-diene-3,10-dione (CAS 32846-64-3) is a chemical compound with the molecular formula C10H6Br2O2 and a molecular weight of 317.96 g/mol. IUPAC name: 4,7-dibromotricyclo[5.2.1.02,6]deca-4,8-diene-3,10-dione. InChIKey: QPIIZGUQJCFMDJ-UHFFFAOYSA-N.
| Molecular formula | C10H6Br2O2 |
|---|---|
| Molecular weight | 317.96 g/mol |
| IUPAC name | 4,7-dibromotricyclo[5.2.1.02,6]deca-4,8-diene-3,10-dione |
| InChIKey | QPIIZGUQJCFMDJ-UHFFFAOYSA-N |
| SMILES | C1=CC2(C3C=C(C(=O)C3C1C2=O)Br)Br |
Computed by PubChem (NCBI)