CAS 2408937-98-2 is the registry number for Rac-(1r,2s,6r,7r)-4,7-dibromotricyclo[5.2.1.0,2,6]deca-4,8-diene-3,10-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
(1S,2R,6S,7S)-4,7-dibromotricyclo[5.2.1.02,6]deca-4,8-diene-3,10-dione (CAS 2408937-98-2) is a chemical compound with the molecular formula C10H6Br2O2 and a molecular weight of 317.96 g/mol. IUPAC name: (1S,2R,6S,7S)-4,7-dibromotricyclo[5.2.1.02,6]deca-4,8-diene-3,10-dione. InChIKey: QPIIZGUQJCFMDJ-IGMRMVRISA-N.
| Molecular formula | C10H6Br2O2 |
|---|---|
| Molecular weight | 317.96 g/mol |
| IUPAC name | (1S,2R,6S,7S)-4,7-dibromotricyclo[5.2.1.02,6]deca-4,8-diene-3,10-dione |
| InChIKey | QPIIZGUQJCFMDJ-IGMRMVRISA-N |
| SMILES | C1=C[C@@]2([C@@H]3C=C(C(=O)[C@@H]3[C@H]1C2=O)Br)Br |
Computed by PubChem (NCBI)