CAS 102153-56-0 is the registry number for 1,8-Dibromonaphthalene-2,7-diol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
1,8-dibromonaphthalene-2,7-diol (CAS 102153-56-0) is a chemical compound with the molecular formula C10H6Br2O2 and a molecular weight of 317.96 g/mol. IUPAC name: 1,8-dibromonaphthalene-2,7-diol. InChIKey: QZBCXYVRBUFFBG-UHFFFAOYSA-N.
| Molecular formula | C10H6Br2O2 |
|---|---|
| Molecular weight | 317.96 g/mol |
| IUPAC name | 1,8-dibromonaphthalene-2,7-diol |
| InChIKey | QZBCXYVRBUFFBG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C=CC(=C2Br)O)Br)O |
Computed by PubChem (NCBI)