CAS 7039-76-1 appears in our catalog under these names: 2-Bromo-1-(5-bromo-1-benzofuran-2-yl)-1-ethanone, 97%, 2–bromo–1–(5–bromo–1–benzofuran–2–yl)ethanone. Offered by: Combi-blocks, Fluorochem, GLPBio. Available pack sizes: 1g, 250mg, 5g, 100mg.
2-bromo-1-(5-bromo-1-benzofuran-2-yl)ethanone (CAS 7039-76-1) is a chemical compound with the molecular formula C10H6Br2O2 and a molecular weight of 317.96 g/mol. IUPAC name: 2-bromo-1-(5-bromo-1-benzofuran-2-yl)ethanone. InChIKey: CWMRSJWOSLJADM-UHFFFAOYSA-N.
| Molecular formula | C10H6Br2O2 |
|---|---|
| Molecular weight | 317.96 g/mol |
| IUPAC name | 2-bromo-1-(5-bromo-1-benzofuran-2-yl)ethanone |
| InChIKey | CWMRSJWOSLJADM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C=C(O2)C(=O)CBr |
Computed by PubChem (NCBI)