cas: 17965-72-9 — see every product listed under this CAS number, including other names
1,5-Naphthyridine, 3,7-dibromo-, 98%, 98% (CAS 17965-72-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11386R-100mg |
| cas | 17965-72-9 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 285.20 Pln | |
| Chemat | 5g | 942.80 Pln | |
| Chemat | 10g | 1715.60 Pln | |
| Chemat | 25g | 3506.00 Pln | |
| Chemat | 50g | 3597.20 Pln | |
| Chemat | 100g | 6328.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3,7-dibromo-1,5-naphthyridine (CAS 17965-72-9) is a chemical compound with the molecular formula C8H4Br2N2 and a molecular weight of 287.94 g/mol. IUPAC name: 3,7-dibromo-1,5-naphthyridine. InChIKey: BHEMSCKUFBIJTI-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2N2 |
|---|---|
| Molecular weight | 287.94 g/mol |
| IUPAC name | 3,7-dibromo-1,5-naphthyridine |
| InChIKey | BHEMSCKUFBIJTI-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1N=CC(=C2)Br)Br |
Computed by PubChem (NCBI)