CAS 54569-27-6 appears in our catalog under these names: 2,4-Dibromo-1,8-naphthyridine, 95%, 2,4-Dibromo-1,8-naphthyridine, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
2,4-dibromo-1,8-naphthyridine (CAS 54569-27-6) is a chemical compound with the molecular formula C8H4Br2N2 and a molecular weight of 287.94 g/mol. IUPAC name: 2,4-dibromo-1,8-naphthyridine. InChIKey: VBFQOVZTYUFQNB-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2N2 |
|---|---|
| Molecular weight | 287.94 g/mol |
| IUPAC name | 2,4-dibromo-1,8-naphthyridine |
| InChIKey | VBFQOVZTYUFQNB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=C1)N=C(C=C2Br)Br |
Computed by PubChem (NCBI)