CAS 1895723-52-0 is the registry number for 4,7-Dibromocinnoline, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
4,7-dibromocinnoline (CAS 1895723-52-0) is a chemical compound with the molecular formula C8H4Br2N2 and a molecular weight of 287.94 g/mol. IUPAC name: 4,7-dibromocinnoline. InChIKey: JIWGLEKQCYLXMJ-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2N2 |
|---|---|
| Molecular weight | 287.94 g/mol |
| IUPAC name | 4,7-dibromocinnoline |
| InChIKey | JIWGLEKQCYLXMJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)N=NC=C2Br |
Computed by PubChem (NCBI)