CAS 17965-75-2 appears in our catalog under these names: 3,8-Dibromo-1,6-naphthyridine, 95%, 3,8-Dibromo-(1,6)naphthyridine, 3,8-Dibromo-1,6-naphthyridine 97%, 3,8-Dibromo-1,6-naphthyridine, 97%, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 10g, 1g, 100mg.
3,8-dibromo-1,6-naphthyridine (CAS 17965-75-2) is a chemical compound with the molecular formula C8H4Br2N2 and a molecular weight of 287.94 g/mol. IUPAC name: 3,8-dibromo-1,6-naphthyridine. InChIKey: XGNQDLUHEFXGPL-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2N2 |
|---|---|
| Molecular weight | 287.94 g/mol |
| IUPAC name | 3,8-dibromo-1,6-naphthyridine |
| InChIKey | XGNQDLUHEFXGPL-UHFFFAOYSA-N |
| SMILES | C1=C2C=NC=C(C2=NC=C1Br)Br |
Computed by PubChem (NCBI)