CAS 872998-61-3 appears in our catalog under these names: 2,4-Dibromoquinazoline, 95%, 2,4–Dibromoquinazoline, 2,4-Dibromoquinazoline 95%, 2,4-Dibromoquinazoline, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 100g, 1g, 10g, 250mg, 100mg.
2,4-dibromoquinazoline (CAS 872998-61-3) is a chemical compound with the molecular formula C8H4Br2N2 and a molecular weight of 287.94 g/mol. IUPAC name: 2,4-dibromoquinazoline. InChIKey: CDBAGRHVFMGOON-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2N2 |
|---|---|
| Molecular weight | 287.94 g/mol |
| IUPAC name | 2,4-dibromoquinazoline |
| InChIKey | CDBAGRHVFMGOON-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NC(=N2)Br)Br |
Computed by PubChem (NCBI)