CAS 72754-04-2 appears in our catalog under these names: 2,6-Dibromo-1,8-naphthyridine, 95%, 2,6-Dibromo-1,8-naphthyridine, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2,6-dibromo-1,8-naphthyridine (CAS 72754-04-2) is a chemical compound with the molecular formula C8H4Br2N2 and a molecular weight of 287.94 g/mol. IUPAC name: 2,6-dibromo-1,8-naphthyridine. InChIKey: DMSVNFHGDCAEJX-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2N2 |
|---|---|
| Molecular weight | 287.94 g/mol |
| IUPAC name | 2,6-dibromo-1,8-naphthyridine |
| InChIKey | DMSVNFHGDCAEJX-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=NC=C(C=C21)Br)Br |
Computed by PubChem (NCBI)