CAS 17965-72-9 appears in our catalog under these names: 3,7-Dibromo-1,5-naphthyridine, 95%, 3,7-Dibromo-1,5-naphthyridine, 3,7-Dibromo-1,5-naphthyridine 98%, 1,5-Naphthyridine, 3,7-dibromo-, 98%, 98%, 3,7-Dibromo-1,5-naphthyridine, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 2,5g, 100mg, 5g, 10g, 25g, 50g.
3,7-dibromo-1,5-naphthyridine (CAS 17965-72-9) is a chemical compound with the molecular formula C8H4Br2N2 and a molecular weight of 287.94 g/mol. IUPAC name: 3,7-dibromo-1,5-naphthyridine. InChIKey: BHEMSCKUFBIJTI-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2N2 |
|---|---|
| Molecular weight | 287.94 g/mol |
| IUPAC name | 3,7-dibromo-1,5-naphthyridine |
| InChIKey | BHEMSCKUFBIJTI-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1N=CC(=C2)Br)Br |
Computed by PubChem (NCBI)