CAS 54920-77-3 appears in our catalog under these names: 2,4-Dibromo-1,7-naphthyridine, 95%, 2,4-dibromo-1,7-naphthyridine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
2,4-dibromo-1,7-naphthyridine (CAS 54920-77-3) is a chemical compound with the molecular formula C8H4Br2N2 and a molecular weight of 287.94 g/mol. IUPAC name: 2,4-dibromo-1,7-naphthyridine. InChIKey: QRYLVKQNHGXLNH-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2N2 |
|---|---|
| Molecular weight | 287.94 g/mol |
| IUPAC name | 2,4-dibromo-1,7-naphthyridine |
| InChIKey | QRYLVKQNHGXLNH-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=C1C(=CC(=N2)Br)Br |
Computed by PubChem (NCBI)