CAS 1353971-28-4 is the registry number for 1,4-Dibromo-2,6-naphthyridine, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.
1,4-dibromo-2,6-naphthyridine (CAS 1353971-28-4) is a chemical compound with the molecular formula C8H4Br2N2 and a molecular weight of 287.94 g/mol. IUPAC name: 1,4-dibromo-2,6-naphthyridine. InChIKey: ACIODXNLNXYRDN-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2N2 |
|---|---|
| Molecular weight | 287.94 g/mol |
| IUPAC name | 1,4-dibromo-2,6-naphthyridine |
| InChIKey | ACIODXNLNXYRDN-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=C1C(=NC=C2Br)Br |
Computed by PubChem (NCBI)