1,5-Naphthyridine-3-carboxylic acid 95%
cas: 90418-64-7 — see every product listed under this CAS number, including other names
1,5-Naphthyridine-3-carboxylic acid 95% (CAS 90418-64-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A227115-50mg |
| cas | 90418-64-7 |
| size | 50mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 954.44 Pln | |
| Ambeed | 100mg | 1343.81 Pln | |
| Ambeed | 250mg | 2050.25 Pln | |
| Ambeed | 1g | 6155.38 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A227115 |
1,5-naphthyridine-3-carboxylic acid (CAS 90418-64-7) is a chemical compound with the molecular formula C9H6N2O2 and a molecular weight of 174.16 g/mol. IUPAC name: 1,5-naphthyridine-3-carboxylic acid. InChIKey: BWIFRKKQXKCKQQ-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2 |
|---|---|
| Molecular weight | 174.16 g/mol |
| IUPAC name | 1,5-naphthyridine-3-carboxylic acid |
| InChIKey | BWIFRKKQXKCKQQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=N2)C(=O)O)N=C1 |
Computed by PubChem (NCBI)