1,6-Dimethylpyrene, 97%
cas: 27984-16-3 — see every product listed under this CAS number, including other names
1,6-Dimethylpyrene, 97% (CAS 27984-16-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1263312-100mg |
| cas | 27984-16-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 698.56 Pln | |
| Ambeed | 250mg | 1304.88 Pln | |
| Ambeed | 1g | 3162.75 Pln | |
| Ambeed | 5g | 12429.88 Pln | |
| BLDpharm | 100mg | 747.54 Pln | |
| BLDpharm | 250mg | 1397.31 Pln | |
| BLDpharm | 1g | 3402.16 Pln | |
| BLDpharm | 5g | 13398.64 Pln | |
| Chemat | 100mg | 774.80 Pln | |
| Chemat | 250mg | 1432.40 Pln | |
| Chemat | 1g | 3491.60 Pln | |
| Chemat | 5g | 13778.00 Pln | |
| Fluorochem | 100mg | 1434.93 Pln | |
| Fluorochem | 250mg | 2663.66 Pln | |
| Fluorochem | 1g | 6355.07 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1,6-dimethylpyrene (CAS 27984-16-3) is a chemical compound with the molecular formula C18H14 and a molecular weight of 230.3 g/mol. IUPAC name: 1,6-dimethylpyrene. InChIKey: ZRMDNMCLOTYRPK-UHFFFAOYSA-N.
| Molecular formula | C18H14 |
|---|---|
| Molecular weight | 230.3 g/mol |
| IUPAC name | 1,6-dimethylpyrene |
| InChIKey | ZRMDNMCLOTYRPK-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC3=C4C2=C(C=C1)C=CC4=C(C=C3)C |
Computed by PubChem (NCBI)
Synonyms:
1,6-Dimethylpyrene, Pyrene, 1,6-dimethyl-