CAS 1249336-72-8 appears in our catalog under these names: 1-(2,5-Dichlorophenyl)-2,2,2-trifluoroethanol, 95%, 1-(2,5-Dichlorophenyl)-2,2,2-trifluoroethanol, 98%, 1-(2,5-Dichlorophenyl)-2,2,2-trifluoroethanol, 97%, 97%, 1-(2,5-Dichlorophenyl)-2,2,2-trifluoroethanol, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
1-(2,5-dichlorophenyl)-2,2,2-trifluoroethanol (CAS 1249336-72-8) is a chemical compound with the molecular formula C8H5Cl2F3O and a molecular weight of 245.02 g/mol. IUPAC name: 1-(2,5-dichlorophenyl)-2,2,2-trifluoroethanol. InChIKey: ZGRGYDBIORRLOX-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2F3O |
|---|---|
| Molecular weight | 245.02 g/mol |
| IUPAC name | 1-(2,5-dichlorophenyl)-2,2,2-trifluoroethanol |
| InChIKey | ZGRGYDBIORRLOX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(C(F)(F)F)O)Cl |
Computed by PubChem (NCBI)