Products 886501-93-5
CAS 886501-93-5 is the registry number for (2,3-Dichloro-6-(trifluoromethyl)phenyl)methanol 95+%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
[2,3-dichloro-6-(trifluoromethyl)phenyl]methanol (CAS 886501-93-5) is a chemical compound with the molecular formula C8H5Cl2F3O and a molecular weight of 245.02 g/mol. IUPAC name: [2,3-dichloro-6-(trifluoromethyl)phenyl]methanol. InChIKey: QVSMHDSDKORSCI-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2F3O |
|---|---|
| Molecular weight | 245.02 g/mol |
| IUPAC name | [2,3-dichloro-6-(trifluoromethyl)phenyl]methanol |
| InChIKey | QVSMHDSDKORSCI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)CO)Cl)Cl |
Computed by PubChem (NCBI)