CAS 1788733-89-0 appears in our catalog under these names: (3,5-Dichloro-4-(trifluoromethyl)phenyl)methanol, 95%, (3,5-Dichloro-4-(trifluoromethyl)phenyl)methanol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
[3,5-dichloro-4-(trifluoromethyl)phenyl]methanol (CAS 1788733-89-0) is a chemical compound with the molecular formula C8H5Cl2F3O and a molecular weight of 245.02 g/mol. IUPAC name: [3,5-dichloro-4-(trifluoromethyl)phenyl]methanol. InChIKey: JOBSMYPMRHDEBL-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2F3O |
|---|---|
| Molecular weight | 245.02 g/mol |
| IUPAC name | [3,5-dichloro-4-(trifluoromethyl)phenyl]methanol |
| InChIKey | JOBSMYPMRHDEBL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)C(F)(F)F)Cl)CO |
Computed by PubChem (NCBI)