CAS 1187989-89-4 appears in our catalog under these names: 3,5-Dichloro-alpha-(trifluoromethyl)benzylAlcohol, 98%, 98%, 1-(3,5-Dichlorophenyl)-2,2,2-trifluoroethanol, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-(3,5-dichlorophenyl)-2,2,2-trifluoroethanol (CAS 1187989-89-4) is a chemical compound with the molecular formula C8H5Cl2F3O and a molecular weight of 245.02 g/mol. IUPAC name: 1-(3,5-dichlorophenyl)-2,2,2-trifluoroethanol. InChIKey: FVZBLVDDXUDKQX-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2F3O |
|---|---|
| Molecular weight | 245.02 g/mol |
| IUPAC name | 1-(3,5-dichlorophenyl)-2,2,2-trifluoroethanol |
| InChIKey | FVZBLVDDXUDKQX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)C(C(F)(F)F)O |
Computed by PubChem (NCBI)