CAS 1824048-31-8 appears in our catalog under these names: 3,4-Dichloro-5-(trifluoromethyl)benzyl alcohol, 95%, 3,4-Dichloro-5-(trifluoromethyl)benzyl alcohol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
[3,4-dichloro-5-(trifluoromethyl)phenyl]methanol (CAS 1824048-31-8) is a chemical compound with the molecular formula C8H5Cl2F3O and a molecular weight of 245.02 g/mol. IUPAC name: [3,4-dichloro-5-(trifluoromethyl)phenyl]methanol. InChIKey: ZDTFSOBHRIJCAX-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2F3O |
|---|---|
| Molecular weight | 245.02 g/mol |
| IUPAC name | [3,4-dichloro-5-(trifluoromethyl)phenyl]methanol |
| InChIKey | ZDTFSOBHRIJCAX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)Cl)Cl)CO |
Computed by PubChem (NCBI)