CAS 1379328-41-2 is the registry number for 4,5-Dichloro-2-(trifluoromethyl)benzyl alcohol. Offered by: Biosynth. Available pack sizes: 1g, 0,5g, 2g, 5g, 10g.
[4,5-dichloro-2-(trifluoromethyl)phenyl]methanol (CAS 1379328-41-2) is a chemical compound with the molecular formula C8H5Cl2F3O and a molecular weight of 245.02 g/mol. IUPAC name: [4,5-dichloro-2-(trifluoromethyl)phenyl]methanol. InChIKey: DBHFXVUVIUYEGQ-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2F3O |
|---|---|
| Molecular weight | 245.02 g/mol |
| IUPAC name | [4,5-dichloro-2-(trifluoromethyl)phenyl]methanol |
| InChIKey | DBHFXVUVIUYEGQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)C(F)(F)F)CO |
Computed by PubChem (NCBI)