Products 1867780-12-8
CAS 1867780-12-8 is the registry number for (R)-1-(2,4-Dichlorophenyl)-2,2,2-trifluoroethan-1-ol, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-(2,4-dichlorophenyl)-2,2,2-trifluoroethanol (CAS 1867780-12-8) is a chemical compound with the molecular formula C8H5Cl2F3O and a molecular weight of 245.02 g/mol. IUPAC name: (1R)-1-(2,4-dichlorophenyl)-2,2,2-trifluoroethanol. InChIKey: PVMHQZFWMAORFX-SSDOTTSWSA-N.
| Molecular formula | C8H5Cl2F3O |
|---|---|
| Molecular weight | 245.02 g/mol |
| IUPAC name | (1R)-1-(2,4-dichlorophenyl)-2,2,2-trifluoroethanol |
| InChIKey | PVMHQZFWMAORFX-SSDOTTSWSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)[C@H](C(F)(F)F)O |
Computed by PubChem (NCBI)